Information card for entry 2222091
| Chemical name |
4,5,6-Tri-<i>O</i>-acetyl-2,3-di-<i>S</i>-ethyl-2,3-dithio-D-allose diethyl dithioacetal |
| Formula |
C20 H36 O6 S4 |
| Calculated formula |
C20 H36 O6 S4 |
| SMILES |
CCS[C@@H]([C@H](C(SCC)SCC)SCC)[C@@H]([C@H](OC(=O)C)COC(=O)C)OC(=O)C |
| Title of publication |
4,5,6-Tri-<i>O</i>-acetyl-2,3-di-<i>S</i>-ethyl-2,3-dithio-<small>D</small>-allose diethyl dithioacetal |
| Authors of publication |
Xi, Xiao-Dong; Shi, Da-Xin; Li, Hui; Li, Yun-Zheng; Wu, Qin-Pei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
6 |
| Pages of publication |
o1227 |
| a |
8.3395 ± 0.0012 Å |
| b |
16.726 ± 0.002 Å |
| c |
9.2027 ± 0.0014 Å |
| α |
90° |
| β |
95.772 ± 0.005° |
| γ |
90° |
| Cell volume |
1277.1 ± 0.3 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.034 |
| Residual factor for significantly intense reflections |
0.0322 |
| Weighted residual factors for significantly intense reflections |
0.0631 |
| Weighted residual factors for all reflections included in the refinement |
0.0655 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222091.html