Information card for entry 2222184
| Chemical name |
5-[(4-Acetylphenyl)aminomethylene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Formula |
C15 H15 N O5 |
| Calculated formula |
C15 H15 N O5 |
| SMILES |
O1C(OC(=O)C(C1=O)=CNc1ccc(cc1)C(=O)C)(C)C |
| Title of publication |
5-[(4-Acetylphenyl)aminomethylene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Authors of publication |
Li, Rui; Ding, Zhen-Yu; Wei, Yu-Quan; Ding, Jian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
6 |
| Pages of publication |
o1297 |
| a |
7.102 ± 0.003 Å |
| b |
7.356 ± 0.004 Å |
| c |
13.856 ± 0.004 Å |
| α |
82.79 ± 0.04° |
| β |
83.19 ± 0.04° |
| γ |
86.03 ± 0.04° |
| Cell volume |
712 ± 0.5 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1264 |
| Residual factor for significantly intense reflections |
0.0637 |
| Weighted residual factors for significantly intense reflections |
0.1581 |
| Weighted residual factors for all reflections included in the refinement |
0.1792 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222184.html