Information card for entry 2222202
| Chemical name |
<i>rac</i>-7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid–2-amino-1,3,4-thiadiazole–water (1/1/1) |
| Formula |
C10 H15 N3 O6 S |
| Calculated formula |
C10 H15 N3 O6 S |
| SMILES |
c1sc(N)nn1.[C@H]12[C@H]([C@H]([C@H](CC1)O2)C(=O)O)C(=O)O.O |
| Title of publication |
<i>rac</i>-7-Oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid–2-amino-1,3,4-thiadiazole–water (1/1/1) |
| Authors of publication |
Wang, Na; Lin, Qiu-Yue; Wang, Yan-Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
7 |
| Pages of publication |
o1590 |
| a |
5.7678 ± 0.0005 Å |
| b |
18.4267 ± 0.0015 Å |
| c |
12.7546 ± 0.0011 Å |
| α |
90° |
| β |
101.336 ± 0.006° |
| γ |
90° |
| Cell volume |
1329.1 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0738 |
| Residual factor for significantly intense reflections |
0.046 |
| Weighted residual factors for significantly intense reflections |
0.1217 |
| Weighted residual factors for all reflections included in the refinement |
0.1332 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222202.html