Information card for entry 2222276
| Chemical name |
(<i>E</i>)-5-Phenyl-<i>N</i>-(2-thienylmethylene)-1,3,4-thiadiazole-2-amine |
| Formula |
C13 H9 N3 S2 |
| Calculated formula |
C13 H9 N3 S2 |
| SMILES |
c1ccccc1c1nnc(/N=C/c2cccs2)s1 |
| Title of publication |
(<i>E</i>)-5-Phenyl-<i>N</i>-(2-thienylmethylene)-1,3,4-thiadiazole-2-amine |
| Authors of publication |
Demirtaş, Güneş; Dege, Necmi; Şekerci, Memet; Servi, Süleyman; Dinçer, Muharrem |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
7 |
| Pages of publication |
o1668 |
| a |
6.2238 ± 0.0003 Å |
| b |
7.7393 ± 0.0003 Å |
| c |
25.6959 ± 0.0013 Å |
| α |
90° |
| β |
94.701 ± 0.004° |
| γ |
90° |
| Cell volume |
1233.55 ± 0.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0317 |
| Residual factor for significantly intense reflections |
0.0262 |
| Weighted residual factors for significantly intense reflections |
0.0774 |
| Weighted residual factors for all reflections included in the refinement |
0.0799 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222276.html