Information card for entry 2222342
| Chemical name |
{2,2'-[1,1'-(Ethylenedioxydinitrilo)diethylidyne]di-1-naphtholato}nickel(II) |
| Formula |
C26 H22 N2 Ni O4 |
| Calculated formula |
C26 H22 N2 Ni O4 |
| SMILES |
[Ni]123[N](OCCO[N]1=C(C)c1c(O3)c3c(cc1)cccc3)=C(C)c1c(O2)c2c(cc1)cccc2 |
| Title of publication |
{2,2'-[1,1'-(Ethylenedioxydinitrilo)diethylidyne]di-1-naphtholato}nickel(II) |
| Authors of publication |
Dong, Wen-Kui; Wu, Jian-Chao; Yao, Jian; Gong, Shang-Sheng; Tong, Jun-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
7 |
| Pages of publication |
m803 |
| a |
13.6975 ± 0.0013 Å |
| b |
8.2711 ± 0.001 Å |
| c |
19.049 ± 0.002 Å |
| α |
90° |
| β |
95.346 ± 0.001° |
| γ |
90° |
| Cell volume |
2148.7 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1055 |
| Residual factor for significantly intense reflections |
0.0475 |
| Weighted residual factors for significantly intense reflections |
0.0959 |
| Weighted residual factors for all reflections included in the refinement |
0.1256 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222342.html