Information card for entry 2222425
| Chemical name |
4,4'-[4,4'-(Perfluoropropane-2,2-diyl)bis(4,1-phenyleneoxy)]dianiline |
| Formula |
C27 H20 F6 N2 O2 |
| Calculated formula |
C27 H20 F6 N2 O2 |
| SMILES |
O(c1ccc(C(C(F)(F)F)(C(F)(F)F)c2ccc(Oc3ccc(N)cc3)cc2)cc1)c1ccc(N)cc1 |
| Title of publication |
4,4'-[4,4'-(Perfluoropropane-2,2-diyl)bis(4,1-phenyleneoxy)]dianiline |
| Authors of publication |
Nawaz, Haq; Akhter, Zareen; Bolte, Michael; Siddiqui, Humaira M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
7 |
| Pages of publication |
o1460 |
| a |
11.6914 ± 0.0012 Å |
| b |
25.641 ± 0.002 Å |
| c |
7.7625 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2327 ± 0.4 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0515 |
| Residual factor for significantly intense reflections |
0.0367 |
| Weighted residual factors for significantly intense reflections |
0.082 |
| Weighted residual factors for all reflections included in the refinement |
0.0878 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.924 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222425.html