Information card for entry 2222433
| Chemical name |
2-(1,2,3,4-Tetrahydrophenanthren-1-ylidene)malononitrile |
| Formula |
C17 H12 N2 |
| Calculated formula |
C17 H12 N2 |
| SMILES |
N#CC(=C1c2c(CCC1)c1ccccc1cc2)C#N |
| Title of publication |
2-(1,2,3,4-Tetrahydrophenanthren-1-ylidene)malononitrile |
| Authors of publication |
Ettenger, George B.; Williams, Brian Wesley; Brillhart, Daniel; Kastner, Margaret E. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
7 |
| Pages of publication |
o1711 |
| a |
7.399 ± 0.0009 Å |
| b |
16.19 ± 0.003 Å |
| c |
10.457 ± 0.0013 Å |
| α |
90° |
| β |
93.016 ± 0.007° |
| γ |
90° |
| Cell volume |
1250.9 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1883 |
| Residual factor for significantly intense reflections |
0.0719 |
| Weighted residual factors for significantly intense reflections |
0.1329 |
| Weighted residual factors for all reflections included in the refinement |
0.1763 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.981 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222433.html