Information card for entry 2222497
| Chemical name |
3',6'-Bis(diethylamino)-2-phenylspiro[isoindoline-1,9'-xanthen]-3-one |
| Formula |
C34 H35 N3 O2 |
| Calculated formula |
C34 H35 N3 O2 |
| SMILES |
c12cc(ccc1C1(c3ccc(cc3O2)N(CC)CC)c2ccccc2C(=O)N1c1ccccc1)N(CC)CC |
| Title of publication |
3',6'-Bis(diethylamino)-2-phenylspiro[isoindoline-1,9'-xanthen]-3-one |
| Authors of publication |
Deng, Wu-Jian; Sun, Di; Su, Bing-Yuan; Wang, Shu-Ping; Zheng, Hong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
7 |
| Pages of publication |
o1464 |
| a |
12.0213 ± 0.0005 Å |
| b |
12.6315 ± 0.0004 Å |
| c |
18.97 ± 0.0007 Å |
| α |
90° |
| β |
107.456 ± 0.004° |
| γ |
90° |
| Cell volume |
2747.88 ± 0.19 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0539 |
| Residual factor for significantly intense reflections |
0.0399 |
| Weighted residual factors for significantly intense reflections |
0.0984 |
| Weighted residual factors for all reflections included in the refinement |
0.1032 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222497.html