Information card for entry 2222615
| Chemical name |
Methyl 1-methyl-3-<i>p</i>-tolyl-1,2,3,3a,4,11c- hexahydrobenzo[<i>f</i>]chromeno[4,3-<i>b</i>]pyrrole-3a-carboxylate |
| Formula |
C25 H25 N O3 |
| Calculated formula |
C25 H25 N O3 |
| SMILES |
[C@H]12c3c4ccccc4ccc3OC[C@]1([C@H](CN2C)c1ccc(cc1)C)C(=O)OC.[C@@H]12c3c4ccccc4ccc3OC[C@@]1([C@@H](CN2C)c1ccc(cc1)C)C(=O)OC |
| Title of publication |
Methyl 1-methyl-3-<i>p</i>-tolyl-1,2,3,3a,4,11c-hexahydrobenzo[<i>f</i>]chromeno[4,3-<i>b</i>]pyrrole-3a-carboxylate |
| Authors of publication |
Nirmala, S.; Kamala, E. Theboral Sugi; Sudha, L.; Kathiravan, S.; Raghunathan, R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o1811 |
| a |
12.9899 ± 0.0006 Å |
| b |
7.6751 ± 0.0003 Å |
| c |
20.5073 ± 0.0009 Å |
| α |
90° |
| β |
96.881 ± 0.002° |
| γ |
90° |
| Cell volume |
2029.83 ± 0.15 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0789 |
| Residual factor for significantly intense reflections |
0.0468 |
| Weighted residual factors for significantly intense reflections |
0.129 |
| Weighted residual factors for all reflections included in the refinement |
0.1558 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222615.html