Information card for entry 2222639
| Chemical name |
Methyl 3-(4-bromophenyl)-1-methyl-1,2,3,3a,4,9b- hexahydrobenzo[<i>f</i>]chromeno[4,3-<i>b</i>]pyrrole-3a-carboxylate |
| Formula |
C24 H22 Br N O3 |
| Calculated formula |
C24 H22 Br N O3 |
| SMILES |
[C@@H]12c3c4ccccc4ccc3OC[C@@]1([C@@H](CN2C)c1ccc(cc1)Br)C(=O)OC.[C@H]12c3c4ccccc4ccc3OC[C@]1([C@H](CN2C)c1ccc(cc1)Br)C(=O)OC |
| Title of publication |
Methyl 3-(4-bromophenyl)-1-methyl-1,2,3,3a,4,9b-hexahydrobenzo[<i>f</i>]chromeno[4,3-<i>b</i>]pyrrole-3a-carboxylate |
| Authors of publication |
Nirmala, S.; Kamala, E. Theboral Sugi; Sudha, L.; Kathiravan, S.; Raghunathan, R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o2028 - o2029 |
| a |
12.7856 ± 0.0004 Å |
| b |
19.9348 ± 0.0006 Å |
| c |
8.0189 ± 0.0003 Å |
| α |
90° |
| β |
106.163 ± 0.002° |
| γ |
90° |
| Cell volume |
1963.06 ± 0.11 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0729 |
| Residual factor for significantly intense reflections |
0.0381 |
| Weighted residual factors for significantly intense reflections |
0.0898 |
| Weighted residual factors for all reflections included in the refinement |
0.1018 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222639.html