Information card for entry 2222645
| Chemical name |
Aqua(furan-2-carboxylato-κ<i>O</i>)(furan-2-carboxylato- κ^2^<i>O</i>,<i>O</i>')(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(II) methanol hemisolvate |
| Formula |
C22.5 H18 Cu N2 O7.5 |
| Calculated formula |
C22.5 H18 Cu N2 O7.5 |
| SMILES |
[Cu]1([n]2cccc3ccc4ccc[n]1c4c23)(OC(=O)c1occc1)(OC(=O)c1occc1)[OH2].OC |
| Title of publication |
Aqua(furan-2-carboxylato-κ<i>O</i>)(furan-2-carboxylato-κ^2^<i>O</i>,<i>O</i>')(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(II) methanol hemisolvate |
| Authors of publication |
Li, Yanfei; Sun, Junshan; Feng, Shanghua; Xue, Ruigang; Wang, Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
m858 |
| a |
34.129 ± 0.017 Å |
| b |
34.129 ± 0.017 Å |
| c |
14.45 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
16831 ± 14 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
88 |
| Hermann-Mauguin space group symbol |
I 41/a :2 |
| Hall space group symbol |
-I 4ad |
| Residual factor for all reflections |
0.1305 |
| Residual factor for significantly intense reflections |
0.055 |
| Weighted residual factors for significantly intense reflections |
0.1411 |
| Weighted residual factors for all reflections included in the refinement |
0.169 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.967 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222645.html