Information card for entry 2222657
| Chemical name |
(<i>Z</i>)-1-(2,4-Difluorophenyl)-3-phenyl-2-(1<i>H</i>-1,2,4-triazol- 1-yl)prop-2-en-1-one |
| Formula |
C17 H11 F2 N3 O |
| Calculated formula |
C17 H11 F2 N3 O |
| SMILES |
c1(c(cc(cc1)F)F)C(=O)C(=C\c1ccccc1)\n1cncn1 |
| Title of publication |
(<i>Z</i>)-1-(2,4-Difluorophenyl)-3-phenyl-2-(1<i>H</i>-1,2,4-triazol-1-yl)prop-2-en-1-one |
| Authors of publication |
Yan, Cong-Yan; Wang, Guang-Zhou; Zhou, Cheng-He |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o2054 |
| a |
11.7595 ± 0.0016 Å |
| b |
7.58 ± 0.001 Å |
| c |
17.068 ± 0.002 Å |
| α |
90° |
| β |
108.067 ± 0.002° |
| γ |
90° |
| Cell volume |
1446.4 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.062 |
| Residual factor for significantly intense reflections |
0.0395 |
| Weighted residual factors for significantly intense reflections |
0.0881 |
| Weighted residual factors for all reflections included in the refinement |
0.1012 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222657.html