Information card for entry 2222735
| Chemical name |
(2-Aminophenyl)[(5<i>S</i>)-5-hydroxy-3,5-dimethyl-4,5-dihydro-1<i>H</i>-\ pyrazol-1-yl]methanone |
| Formula |
C12 H15 N3 O2 |
| Calculated formula |
C12 H15 N3 O2 |
| SMILES |
O=C(N1N=C(CC1(O)C)C)c1c(N)cccc1 |
| Title of publication |
(2-Aminophenyl)[(5<i>S</i>)-5-hydroxy-3,5-dimethyl-4,5-dihydro-1<i>H</i>-pyrazol-1-yl]methanone |
| Authors of publication |
Arfan, Mohammad; Tahir, M. Nawaz; Khan, Rasool; Saba, Sumbal; Iqbal, Mohammad S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o1834 - o1835 |
| a |
23.5705 ± 0.0007 Å |
| b |
11.3547 ± 0.0004 Å |
| c |
9.1848 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2458.18 ± 0.14 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.0596 |
| Residual factor for significantly intense reflections |
0.0442 |
| Weighted residual factors for significantly intense reflections |
0.1157 |
| Weighted residual factors for all reflections included in the refinement |
0.1259 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222735.html