Information card for entry 2222836
| Chemical name |
Aqua(2,9-dimethyl-1,10-phenanthroline-κ^2^N,N')bis(3-hydroxybenzoato- κO)manganese(II)–2,9-dimethyl-1,10-phenanthroline–water (1/1/1) |
| Formula |
C42 H38 Mn N4 O8 |
| Calculated formula |
C42 H38 Mn N4 O8 |
| SMILES |
[Mn]1([OH2])(OC(=O)c2cccc(O)c2)(OC(=O)c2cc(O)ccc2)[n]2c(C)ccc3ccc4ccc([n]1c4c23)C.O.n1c(ccc2ccc3ccc(nc3c12)C)C |
| Title of publication |
Aqua(2,9-dimethyl-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(3-hydroxybenzoato-κ<i>O</i>)manganese(II)–2,9-dimethyl-1,10-phenanthroline–water (1/1/1) |
| Authors of publication |
Liu, Xuejun; Jin, Linyu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
m901 |
| a |
14.7103 ± 0.0016 Å |
| b |
18.578 ± 0.002 Å |
| c |
14.4598 ± 0.0016 Å |
| α |
90° |
| β |
106.302 ± 0.001° |
| γ |
90° |
| Cell volume |
3792.8 ± 0.7 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1081 |
| Residual factor for significantly intense reflections |
0.0538 |
| Weighted residual factors for significantly intense reflections |
0.1218 |
| Weighted residual factors for all reflections included in the refinement |
0.1505 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222836.html