Information card for entry 2222884
| Chemical name |
{4,4'-Dibromo-2,2'-[ethane-1,2-\ diylbis(nitrilomethylidyne)]diphenolato}copper(II) |
| Formula |
C16 H12 Br2 Cu N2 O2 |
| Calculated formula |
C16 H12 Br2 Cu N2 O2 |
| SMILES |
[Cu]123Oc4ccc(cc4C=[N]2CC[N]3=Cc2c(ccc(c2)Br)O1)Br |
| Title of publication |
{4,4'-Dibromo-2,2'-[ethane-1,2-diylbis(nitrilomethylidyne)]diphenolato}copper(II) |
| Authors of publication |
Xie, Qing-Fan; Chen, Yan-Min; Huang, Miao-Ling |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
m903 |
| a |
8.2848 ± 0.0004 Å |
| b |
9.6302 ± 0.0005 Å |
| c |
10.9984 ± 0.0006 Å |
| α |
115.601 ± 0.006° |
| β |
92.866 ± 0.004° |
| γ |
101.527 ± 0.005° |
| Cell volume |
766.1 ± 0.08 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.038 |
| Residual factor for significantly intense reflections |
0.027 |
| Weighted residual factors for significantly intense reflections |
0.059 |
| Weighted residual factors for all reflections included in the refinement |
0.06 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222884.html