Information card for entry 2223028
| Chemical name |
4-Amino-3-[(4-methoxyphenyl)aminomethyl]-1<i>H</i>-1,2,4-triazole- 5(4<i>H</i>)-thione |
| Formula |
C10 H13 N5 O S |
| Calculated formula |
C10 H13 N5 O S |
| SMILES |
S=C1NN=C(N1N)CNc1ccc(OC)cc1 |
| Title of publication |
4-Amino-3-[(4-methoxyphenyl)aminomethyl]-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Authors of publication |
Fun, Hoong-Kun; Yeap, Chin Sing; Malladi, Shridhar; Padaki, Mahesh; Isloor, Arun M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2213 |
| a |
11.5142 ± 0.0002 Å |
| b |
5.8804 ± 0.0001 Å |
| c |
16.6891 ± 0.0003 Å |
| α |
90° |
| β |
95.292 ± 0.001° |
| γ |
90° |
| Cell volume |
1125.17 ± 0.03 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.0383 |
| Residual factor for significantly intense reflections |
0.0311 |
| Weighted residual factors for significantly intense reflections |
0.0646 |
| Weighted residual factors for all reflections included in the refinement |
0.068 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223028.html