Information card for entry 2223043
| Chemical name |
4,4,5,5-Tetramethyl-2-(3,4,5-trimethoxyphenyl)imidazolidine-1-oxyl 3-oxide |
| Formula |
C16 H23 N2 O5 |
| Calculated formula |
C16 H23 N2 O5 |
| SMILES |
[N]1(=O)C(C(N(=O)=C1c1cc(OC)c(OC)c(OC)c1)(C)C)(C)C |
| Title of publication |
4,4,5,5-Tetramethyl-2-(3,4,5-trimethoxyphenyl)imidazolidine-1-oxyl 3-oxide |
| Authors of publication |
Wang, Hai-Bo; Jing, Lin-Lin; Gao, Peng; Sun, Xiao-Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2090 |
| a |
20.623 ± 0.003 Å |
| b |
7.2168 ± 0.0012 Å |
| c |
22.831 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3398 ± 1 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0939 |
| Residual factor for significantly intense reflections |
0.0462 |
| Weighted residual factors for significantly intense reflections |
0.1106 |
| Weighted residual factors for all reflections included in the refinement |
0.1186 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223043.html