Information card for entry 2223116
| Chemical name |
κ^2^<i>N</i>,<i>N</i>']gadolinium(III) |
| Formula |
C62 H51 Gd N2 O6 |
| Calculated formula |
C62 H51 Gd N2 O6 |
| SMILES |
C1(c2ccccc2)=CC(c2ccccc2)=[O][Gd]234([n]5ccccc5c5cc6c(c[n]25)[C@H]2C[C@@H](C6)C2(C)C)(O1)([O]=C(c1ccccc1)C=C(c1ccccc1)O3)[O]=C(c1ccccc1)C=C(c1ccccc1)O4 |
| Title of publication |
Tris(dibenzoylmethanido-κ^2^<i>O</i>,<i>O</i>')[(6<i>S</i>,8<i>S</i>)-(+)-7,7-dimethyl-3-(2-pyridyl)-5,6,7,8-tetrahydro-6,8-methanoisoquinoline-κ^2^<i>N</i>,<i>N</i>']gadolinium(III) |
| Authors of publication |
Li, Xi-Li; He, Lai-Fu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
m1050 |
| a |
9.5303 ± 0.0019 Å |
| b |
20.814 ± 0.004 Å |
| c |
12.735 ± 0.002 Å |
| α |
90° |
| β |
92.421 ± 0.004° |
| γ |
90° |
| Cell volume |
2523.9 ± 0.8 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0352 |
| Residual factor for significantly intense reflections |
0.0337 |
| Weighted residual factors for significantly intense reflections |
0.0728 |
| Weighted residual factors for all reflections included in the refinement |
0.0735 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223116.html