Information card for entry 2223125
| Chemical name |
<i>N</i>,<i>N</i>'-Bis(2-thienylmethylene)benzene-1,4-diamine |
| Formula |
C16 H12 N2 S2 |
| Calculated formula |
C16 H12 N2 S2 |
| SMILES |
c1csc(c1)/C=N/c1ccc(cc1)/N=C/c1cccs1 |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(2-thienylmethylene)benzene-1,4-diamine |
| Authors of publication |
Dong, Nai-Wei; Jia, Dong-Xue; Gan, Chun-Li; Zhou, Dong-Mei; Liu, Feng-Zhi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2190 |
| a |
6.1882 ± 0.0007 Å |
| b |
7.2371 ± 0.0009 Å |
| c |
16.375 ± 0.002 Å |
| α |
90° |
| β |
95.86 ± 0.002° |
| γ |
90° |
| Cell volume |
729.52 ± 0.15 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0755 |
| Residual factor for significantly intense reflections |
0.0651 |
| Weighted residual factors for significantly intense reflections |
0.1798 |
| Weighted residual factors for all reflections included in the refinement |
0.1956 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.003 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223125.html