Information card for entry 2223138
| Chemical name |
<i>catena</i>-Poly[[[triaqua(4,5-diazafluorene-9-one)cadmium]-μ- benzene-1,3-dicarboxylato] dihydrate] |
| Formula |
C19 H20 Cd N2 O10 |
| Calculated formula |
C19 H20 Cd N2 O10 |
| SMILES |
[Cd]12([O]=C(O1)c1cccc(c1)C(=O)[O-])([OH2])([OH2])([OH2])[n]1cccc3C(=O)c4ccc[n]2c4c13.O.O |
| Title of publication |
<i>catena</i>-Poly[[[triaqua(4,5-diazafluorene-9-one)cadmium]-μ-benzene-1,3-dicarboxylato] dihydrate] |
| Authors of publication |
Li, Xiao-Ping; Fang, Wei; Mei, Ze-Min; Jin, Xiang-Jun; Qi, Wen-Liang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
m1069 - m1070 |
| a |
6.9383 ± 0.001 Å |
| b |
10.807 ± 0.0016 Å |
| c |
14.429 ± 0.002 Å |
| α |
96.268 ± 0.002° |
| β |
92.602 ± 0.002° |
| γ |
102.019 ± 0.002° |
| Cell volume |
1049.3 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0441 |
| Residual factor for significantly intense reflections |
0.0369 |
| Weighted residual factors for significantly intense reflections |
0.0876 |
| Weighted residual factors for all reflections included in the refinement |
0.0925 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223138.html