Information card for entry 2223198
| Chemical name |
<i>trans</i>-(Pyrimidine-2-thiolato-κ^2^<i>N</i>,<i>S</i>)[tris(2- aminoethyl)amine-κ^4^<i>N</i>,<i>N</i>',<i>N</i>'',<i>N</i>''']cobalt(III) chloride hexafluoridophosphate |
| Formula |
C10 H21 Cl Co F6 N6 P S |
| Calculated formula |
C10 H21 Cl Co F6 N6 P S |
| SMILES |
[Co]1234(Sc5[n]1cccn5)[N](CC[NH2]2)(CC[NH2]3)CC[NH2]4.[P](F)(F)(F)(F)(F)[F-].[Cl-] |
| Title of publication |
<i>trans</i>-(Pyrimidine-2-thiolato-κ^2^<i>N</i>,<i>S</i>)[tris(2-aminoethyl)amine-κ^4^<i>N</i>,<i>N</i>',<i>N</i>'',<i>N</i>''']cobalt(III) chloride hexafluoridophosphate |
| Authors of publication |
Fujihara, Keisuke; Yonemura, Toshiaki |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
m1127 - m1128 |
| a |
12.7106 ± 0.0017 Å |
| b |
11.326 ± 0.002 Å |
| c |
14.205 ± 0.002 Å |
| α |
90° |
| β |
112.549 ± 0.01° |
| γ |
90° |
| Cell volume |
1888.6 ± 0.5 Å3 |
| Cell temperature |
296.1 K |
| Ambient diffraction temperature |
296.1 K |
| Number of distinct elements |
8 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0573 |
| Weighted residual factors for all reflections included in the refinement |
0.1741 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223198.html