Information card for entry 2223292
| Chemical name |
4-Methyl-2-oxo-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepine-5-carbaldehyde |
| Formula |
C11 H12 N2 O2 |
| Calculated formula |
C11 H12 N2 O2 |
| SMILES |
O=C1Nc2c(N(C(C1)C)C=O)cccc2 |
| Title of publication |
4-Methyl-2-oxo-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepine-5-carbaldehyde |
| Authors of publication |
Ravichandran, K.; Sakthivel, P.; Ponnuswamy, S.; Ramesh, P.; Ponnuswamy, M. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
10 |
| Pages of publication |
o2362 |
| a |
5.3284 ± 0.0001 Å |
| b |
12.9387 ± 0.0004 Å |
| c |
14.6227 ± 0.0005 Å |
| α |
90° |
| β |
97.968 ± 0.002° |
| γ |
90° |
| Cell volume |
998.39 ± 0.05 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0888 |
| Residual factor for significantly intense reflections |
0.0549 |
| Weighted residual factors for significantly intense reflections |
0.1434 |
| Weighted residual factors for all reflections included in the refinement |
0.1625 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223292.html