Information card for entry 2223300
| Chemical name |
1,3-Dimethyl-5-(2-methylbenzylidene)pyrimidine- 2,4,6(1<i>H</i>,3<i>H</i>,5<i>H</i>)trione |
| Formula |
C14 H14 N2 O3 |
| Calculated formula |
C14 H14 N2 O3 |
| SMILES |
c1(ccccc1C)/C=C\1C(=O)N(C(=O)N(C1=O)C)C |
| Title of publication |
1,3-Dimethyl-5-(2-methylbenzylidene)pyrimidine-2,4,6(1<i>H</i>,3<i>H</i>,5<i>H</i>)-trione |
| Authors of publication |
Panchatcharam, R.; Dhayalan, V.; Mohanakrishnan, A. K.; Chakkaravarthi, G.; Manivannan, V. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
10 |
| Pages of publication |
o2394 |
| a |
8.182 ± 0.005 Å |
| b |
8.334 ± 0.004 Å |
| c |
18.202 ± 0.005 Å |
| α |
90° |
| β |
94.267 ± 0.005° |
| γ |
90° |
| Cell volume |
1237.7 ± 1 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1031 |
| Residual factor for significantly intense reflections |
0.0716 |
| Weighted residual factors for significantly intense reflections |
0.2077 |
| Weighted residual factors for all reflections included in the refinement |
0.2375 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223300.html