Information card for entry 2223364
| Chemical name |
<i>N</i>^1^,<i>N</i>^2^-Bis(2,6-dimethylphenyl)-<i>N</i>^1^-hydroxyformamidine <i>N</i>,<i>N</i>'-bis(2,6-dimethylphenyl)-<i>N</i>-oxidoformamidinium dichloromethane solvate |
| Formula |
C35 H42 Cl2 N4 O2 |
| Calculated formula |
C35 H42 Cl2 N4 O2 |
| SMILES |
ClCCl.O=N(=CNc1c(cccc1C)C)c1c(cccc1C)C.ON(/C=N/c1c(cccc1C)C)c1c(cccc1C)C |
| Title of publication |
<i>N</i>^1^,<i>N</i>^2^-Bis(2,6-dimethylphenyl)-<i>N</i>^1^-hydroxyformamidine <i>N</i>,<i>N</i>'-bis(2,6-dimethylphenyl)-<i>N</i>-oxidoformamidinium dichloromethane solvate |
| Authors of publication |
Cibian, Mihaela; Derossi, Sofia; Hanan, Garry S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
10 |
| Pages of publication |
o2485 |
| a |
16.36 ± 0.005 Å |
| b |
18.137 ± 0.006 Å |
| c |
11.421 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3388.9 ± 1.9 Å3 |
| Cell temperature |
200 K |
| Ambient diffraction temperature |
200 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0809 |
| Residual factor for significantly intense reflections |
0.0485 |
| Weighted residual factors for significantly intense reflections |
0.1173 |
| Weighted residual factors for all reflections included in the refinement |
0.1356 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223364.html