Information card for entry 2223375
| Common name |
1,10-phenanthrolinium hydrogen 4,5-dichlorophthalate |
| Chemical name |
1,10-Phenanthrolin-1-ium 2-carboxy-4,5-dichlorobenzoate |
| Formula |
C20 H12 Cl2 N2 O4 |
| Calculated formula |
C20 H12 Cl2 N2 O4 |
| SMILES |
[nH+]1cccc2ccc3cccnc3c12.Clc1cc(c(cc1Cl)C(=O)O)C(=O)[O-] |
| Title of publication |
1,10-Phenanthrolin-1-ium 2-carboxy-4,5-dichlorobenzoate |
| Authors of publication |
Smith, Graham; Wermuth, Urs D.; White, Jonathan M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
10 |
| Pages of publication |
o2333 |
| a |
6.4598 ± 0.0011 Å |
| b |
7.3696 ± 0.0012 Å |
| c |
18.302 ± 0.003 Å |
| α |
90° |
| β |
94.978 ± 0.003° |
| γ |
90° |
| Cell volume |
868 ± 0.2 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0329 |
| Residual factor for significantly intense reflections |
0.0319 |
| Weighted residual factors for significantly intense reflections |
0.0844 |
| Weighted residual factors for all reflections included in the refinement |
0.0853 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223375.html