Information card for entry 2223383
| Chemical name |
Bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-(3,5-di-<i>tert</i>-butyl-4-hydroxybenzyl)malonate |
| Formula |
C42 H72 N2 O5 |
| Calculated formula |
C42 H72 N2 O5 |
| SMILES |
O=C(OC1CC(N(C(C1)(C)C)C)(C)C)C(C(=O)OC1CC(N(C(C1)(C)C)C)(C)C)(CCCC)Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
| Title of publication |
Bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-(3,5-di-<i>tert</i>-butyl-4-hydroxybenzyl)malonate (Tinuvin 144) |
| Authors of publication |
Zeng, Tao; Ren, Wan-Zhong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
10 |
| Pages of publication |
o2357 |
| a |
13.736 ± 0.006 Å |
| b |
18.827 ± 0.008 Å |
| c |
17.185 ± 0.007 Å |
| α |
90° |
| β |
108.679 ± 0.008° |
| γ |
90° |
| Cell volume |
4210 ± 3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.131 |
| Residual factor for significantly intense reflections |
0.0514 |
| Weighted residual factors for significantly intense reflections |
0.1084 |
| Weighted residual factors for all reflections included in the refinement |
0.1325 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223383.html