Information card for entry 2223429
| Common name |
(<i>E</i>)-3-(6-Nitrobenzo[d][1,3]dioxol-5-yl)-1-(2,4,6- trimethoxy)prop-2-en-1-one |
| Chemical name |
(<i>E</i>)-3-(6-Nitrobenzo[<i>d</i>][1,3]dioxol-5-yl)-1-(2,4,6- trimethoxyphenyl) prop-2-en-1-one |
| Formula |
C19 H17 N O8 |
| Calculated formula |
C19 H17 N O8 |
| SMILES |
O=C(/C=C/c1c(N(=O)=O)cc2OCOc2c1)c1c(OC)cc(OC)cc1OC |
| Title of publication |
(<i>E</i>)-3-(6-Nitrobenzo[<i>d</i>][1,3]dioxol-5-yl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| Authors of publication |
Loghmani-Khouzani, Hossein; Abdul Rahman, Noorsaadah; Robinson, Ward T.; Yaeghoobi, Marzieh; Kia, Reza |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
10 |
| Pages of publication |
o2545 |
| a |
7.3044 ± 0.0001 Å |
| b |
10.1264 ± 0.0001 Å |
| c |
12.86 ± 0.0002 Å |
| α |
93.112 ± 0.001° |
| β |
103.959 ± 0.001° |
| γ |
105.384 ± 0.001° |
| Cell volume |
882.91 ± 0.02 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0359 |
| Residual factor for significantly intense reflections |
0.0319 |
| Weighted residual factors for significantly intense reflections |
0.0792 |
| Weighted residual factors for all reflections included in the refinement |
0.0829 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223429.html