Information card for entry 2223832
| Chemical name |
2,3-[(3,6-Dioxaoctane-1,8-diyl)bis(sulfanediylmethylene)]-6,7- bis(methylsulfanyl)-1,4,5,8-tetrathiafulvalene |
| Formula |
C16 H22 O2 S8 |
| Calculated formula |
C16 H22 O2 S8 |
| SMILES |
CSC1=C(SC(=C2SC3=C(CSCCOCCOCCSC3)S2)S1)SC |
| Title of publication |
2,3-[(3,6-Dioxaoctane-1,8-diyl)bis(sulfanediylmethylene)]-6,7-bis(methylsulfanyl)-1,4,5,8-tetrathiafulvalene |
| Authors of publication |
Hou, Rui-Bin; Li, Bao; Chen, Tie; Yin, Bing-Zhu; Wu, Li-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2783 |
| a |
9.1748 ± 0.0018 Å |
| b |
10.177 ± 0.002 Å |
| c |
14.273 ± 0.003 Å |
| α |
98.49 ± 0.03° |
| β |
105.58 ± 0.03° |
| γ |
113.33 ± 0.03° |
| Cell volume |
1129.1 ± 0.6 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.048 |
| Residual factor for significantly intense reflections |
0.0415 |
| Weighted residual factors for significantly intense reflections |
0.1246 |
| Weighted residual factors for all reflections included in the refinement |
0.1283 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.169 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223832.html