Information card for entry 2223892
| Chemical name |
6-Isopropyl-3-phenyl-5-(<i>p</i>-tolyloxy)-3<i>H</i>-1,2,3- triazolo[4,5-<i>d</i>]pyrimidin-7(6<i>H</i>)-one |
| Formula |
C20 H19 N5 O2 |
| Calculated formula |
C20 H19 N5 O2 |
| SMILES |
Cc1ccc(cc1)Oc1nc2c(c(=O)n1C(C)C)nnn2c1ccccc1 |
| Title of publication |
6-Isopropyl-3-phenyl-5-(<i>p</i>-tolyloxy)-3<i>H</i>-1,2,3-triazolo[4,5-<i>d</i>]pyrimidin-7(6<i>H</i>)-one: whole-molecule disorder |
| Authors of publication |
Zeng, Xiao-Hua; Deng, Shou-Heng; Chen, Ping; Wang, Hong-Mei; Gao, Hai-Tao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2653 - o2654 |
| a |
10.2335 ± 0.0006 Å |
| b |
21.8532 ± 0.0012 Å |
| c |
16.7441 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3744.6 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
20 |
| Hermann-Mauguin space group symbol |
C 2 2 21 |
| Hall space group symbol |
C 2c 2 |
| Residual factor for all reflections |
0.0592 |
| Residual factor for significantly intense reflections |
0.0496 |
| Weighted residual factors for significantly intense reflections |
0.1297 |
| Weighted residual factors for all reflections included in the refinement |
0.1443 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223892.html