Information card for entry 2223901
| Chemical name |
Di-μ-nitrito- κ^3^<i>O</i>:<i>O</i>,<i>O</i>';κ^3^<i>O</i>,<i>O</i>':<i>O</i>- bis{[2,6-bis(pyrazol-1-yl-κ<i>N</i>^2^)pyridine-κ<i>N</i>](nitrito- κ^2^<i>O</i>,<i>O</i>')cadmium(II)} |
| Formula |
C22 H18 Cd2 N14 O8 |
| Calculated formula |
C22 H18 Cd2 N14 O8 |
| SMILES |
c1ccn2c3cccc4[n]3[Cd]356([n]12)([n]1n4ccc1)([O]=N[O]3[Cd]1234([n]7cccn7c7cccc([n]17)n1ccc[n]21)([O]=N[O]53)ON=[O]4)ON=[O]6 |
| Title of publication |
Di-μ-nitrito-κ^3^<i>O</i>:<i>O</i>,<i>O</i>';κ^3^<i>O</i>,<i>O</i>':<i>O</i>-bis{[2,6-bis(pyrazol-1-yl-κ<i>N</i>^2^)pyridine-κ<i>N</i>](nitrito-κ^2^<i>O</i>,<i>O</i>')cadmium(II)} |
| Authors of publication |
Sun, Ting Ting; Meng, Lin; Shi, Jing Min |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
m1318 |
| a |
7.7618 ± 0.0013 Å |
| b |
9.5522 ± 0.0016 Å |
| c |
10.9665 ± 0.0019 Å |
| α |
110.285 ± 0.002° |
| β |
90.616 ± 0.002° |
| γ |
112.155 ± 0.002° |
| Cell volume |
696.9 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0312 |
| Residual factor for significantly intense reflections |
0.0289 |
| Weighted residual factors for significantly intense reflections |
0.0747 |
| Weighted residual factors for all reflections included in the refinement |
0.0757 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.091 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223901.html