Information card for entry 2224087
| Chemical name |
Di-μ-chlorido-bis[chlorido(<i>N</i>,<i>N</i>'-dibenzylpropane-1,2- diamine-κ^2^<i>N</i>,<i>N</i>')copper(II)] |
| Formula |
C34 H44 Cl4 Cu2 N4 |
| Calculated formula |
C34 H44 Cl4 Cu2 N4 |
| SMILES |
C1(C[NH](Cc2ccccc2)[Cu]([NH]1Cc1ccccc1)(Cl)Cl)C |
| Title of publication |
Di-μ-chlorido-bis[chlorido(<i>N</i>,<i>N</i>'-dibenzylpropane-1,2-diamine-κ^2^<i>N</i>,<i>N</i>')copper(II)] |
| Authors of publication |
Liu, Yu-Fen; Rong, Da-Fu; Xia, Hai-Tao; Wang, Da-Qi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
m1492 |
| a |
21.07 ± 0.002 Å |
| b |
13.7377 ± 0.0017 Å |
| c |
13.2449 ± 0.0016 Å |
| α |
90° |
| β |
114.317 ± 0.002° |
| γ |
90° |
| Cell volume |
3493.7 ± 0.7 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0973 |
| Residual factor for significantly intense reflections |
0.0511 |
| Weighted residual factors for significantly intense reflections |
0.0873 |
| Weighted residual factors for all reflections included in the refinement |
0.1036 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224087.html