Information card for entry 2224094
| Chemical name |
2,2,6,6-Tetramethylpiperidinium triisopropoxysilanethiolate |
| Formula |
C18 H41 N O3 S Si |
| Calculated formula |
C18 H41 N O3 S Si |
| SMILES |
C(C)(C)O[Si](OC(C)C)(OC(C)C)[S-].C1CCC(C)(C)[NH2+]C1(C)C |
| Title of publication |
2,2,6,6-Tetramethylpiperidinium triisopropoxysilanethiolate |
| Authors of publication |
Baranowska, Katarzyna; Roman, Paweł; Socha, Justyna |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
11 |
| Pages of publication |
o2825 |
| a |
9.2433 ± 0.0006 Å |
| b |
11.5545 ± 0.0008 Å |
| c |
11.7593 ± 0.0007 Å |
| α |
85.955 ± 0.005° |
| β |
77.19 ± 0.006° |
| γ |
67.62 ± 0.006° |
| Cell volume |
1132.28 ± 0.14 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.049 |
| Residual factor for significantly intense reflections |
0.049 |
| Weighted residual factors for significantly intense reflections |
0.116 |
| Weighted residual factors for all reflections included in the refinement |
0.122 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224094.html
