Information card for entry 2224118
| Chemical name |
(3<i>E</i>,5<i>E</i>)-3,5-Bis(4-allyloxybenzylidene)-1-benzylpiperidin-4-one |
| Formula |
C32 H31 N O3 |
| Calculated formula |
C32 H31 N O3 |
| SMILES |
C=CCOc1ccc(cc1)/C=C1\CN(Cc2ccccc2)C/C(=C\c2ccc(cc2)OCC=C)C1=O |
| Title of publication |
(3<i>E</i>,5<i>E</i>)-3,5-Bis(4-allyloxybenzylidene)-1-benzylpiperidin-4-one |
| Authors of publication |
Karthikeyan, N. S.; Sathiyanarayanan, K.; Aravindan, P. G.; Ghosh, H.; Rathore, R. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3062 |
| a |
15.6161 ± 0.0004 Å |
| b |
9.2654 ± 0.0002 Å |
| c |
18.9696 ± 0.0005 Å |
| α |
90° |
| β |
111.031 ± 0.001° |
| γ |
90° |
| Cell volume |
2561.87 ± 0.11 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0575 |
| Residual factor for significantly intense reflections |
0.0414 |
| Weighted residual factors for significantly intense reflections |
0.1007 |
| Weighted residual factors for all reflections included in the refinement |
0.1138 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224118.html