Information card for entry 2224129
| Chemical name |
4-(2,3-Dihydroxybenzylideneamino)-3-methyl-1<i>H</i>-1,2,4-triazol- 5(4<i>H</i>)-one |
| Formula |
C10 H10 N4 O3 |
| Calculated formula |
C10 H10 N4 O3 |
| SMILES |
c1(cccc(c1O)O)/C=N/N1C(=O)NN=C1C |
| Title of publication |
4-(2,3-Dihydroxybenzylideneamino)-3-methyl-1<i>H</i>-1,2,4-triazol-5(4<i>H</i>)-one |
| Authors of publication |
Tanak, Hasan; Köysal, Yavuz; Yavuz, Metin; Işık, Şamil; Gül, Gülşah |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3039 |
| a |
13.944 ± 0.003 Å |
| b |
6.2551 ± 0.0007 Å |
| c |
11.882 ± 0.002 Å |
| α |
90° |
| β |
93.857 ± 0.017° |
| γ |
90° |
| Cell volume |
1034 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.0402 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.1148 |
| Weighted residual factors for all reflections included in the refinement |
0.1163 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.089 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224129.html