Information card for entry 2224401
| Chemical name |
<i>N</i>,1-Bis(4-chloro-2-methylbenzyl)-3-methyl-2-oxo-1,2,3,4- tetrahydroquinoline-3-carboxamide |
| Formula |
C27 H26 Cl2 N2 O2 |
| Calculated formula |
C27 H26 Cl2 N2 O2 |
| SMILES |
Clc1ccc(CNC(=O)C2(C(=O)N(c3c(C2)cccc3)Cc2ccc(Cl)cc2C)C)c(c1)C |
| Title of publication |
<i>N</i>,1-Bis(4-chloro-2-methylbenzyl)-3-methyl-2-oxo-1,2,3,4-tetrahydroquinoline-3-carboxamide |
| Authors of publication |
Porosa, Lukasz; Viirre, Russell D.; Lough, Alan J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3090 |
| a |
10.1394 ± 0.0006 Å |
| b |
10.7095 ± 0.0006 Å |
| c |
12.2542 ± 0.0004 Å |
| α |
82.084 ± 0.003° |
| β |
71.403 ± 0.003° |
| γ |
66.519 ± 0.002° |
| Cell volume |
1156.66 ± 0.1 Å3 |
| Cell temperature |
150 ± 1 K |
| Ambient diffraction temperature |
150 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1321 |
| Residual factor for significantly intense reflections |
0.064 |
| Weighted residual factors for significantly intense reflections |
0.15 |
| Weighted residual factors for all reflections included in the refinement |
0.184 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224401.html