Information card for entry 2224420
| Chemical name |
[<i>N</i>,<i>N</i>'-Bis(3-methoxy-2-oxidobenzylidene)ethylenediammonium- κ^4^<i>O</i>,<i>O</i>',<i>O</i>'',<i>O</i>''']tris(nitrato- κ^2^<i>O</i>,<i>O</i>')dysprosium(III) |
| Formula |
C18 H20 Dy N5 O13 |
| Calculated formula |
C18 H20 Dy N5 O13 |
| SMILES |
c12c3cccc1=CNCCNC=c1cccc4c1=[O][Dy]156([O]=2)([O]3C)([O]4C)(ON(=O)=[O]1)(ON(=O)=[O]5)[O]=N(=O)O6 |
| Title of publication |
[<i>N</i>,<i>N</i>'-Bis(3-methoxy-2-oxidobenzylidene)ethylenediammonium-κ^4^<i>O</i>,<i>O</i>',<i>O</i>'',<i>O</i>''']tris(nitrato-κ^2^<i>O</i>,<i>O</i>')dysprosium(III) |
| Authors of publication |
Gao, Ting; Li, Guang-Ming; Gao, Po; Yan, Peng-Fei; Hou, Guang-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
m1585 |
| a |
14.126 ± 0.005 Å |
| b |
11.86 ± 0.004 Å |
| c |
14.628 ± 0.004 Å |
| α |
90° |
| β |
104.302 ± 0.012° |
| γ |
90° |
| Cell volume |
2374.7 ± 1.3 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0237 |
| Residual factor for significantly intense reflections |
0.0196 |
| Weighted residual factors for significantly intense reflections |
0.0428 |
| Weighted residual factors for all reflections included in the refinement |
0.0451 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.104 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224420.html