Information card for entry 2224438
| Chemical name |
3-(2-Amino-1,3-thiazol-4-yl)-6-bromo-2<i>H</i>-chromen-2-one |
| Formula |
C12 H7 Br N2 O2 S |
| Calculated formula |
C12 H7 Br N2 O2 S |
| SMILES |
Brc1cc2cc(c(=O)oc2cc1)c1nc(sc1)N |
| Title of publication |
3-(2-Amino-1,3-thiazol-4-yl)-6-bromo-2<i>H</i>-chromen-2-one |
| Authors of publication |
Chopra, Deepak; Choudhury, A. R.; Venugopala, K. N.; Govender, Thavendran; Kruger, Hendrik G.; Maguire, Glenn E. M.; Guru Row, T. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3047 - o3048 |
| a |
7.031 ± 0.004 Å |
| b |
13.804 ± 0.008 Å |
| c |
12.453 ± 0.007 Å |
| α |
90° |
| β |
90.047 ± 0.009° |
| γ |
90° |
| Cell volume |
1208.6 ± 1.2 Å3 |
| Cell temperature |
290 ± 2 K |
| Ambient diffraction temperature |
290 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0431 |
| Residual factor for significantly intense reflections |
0.0339 |
| Weighted residual factors for significantly intense reflections |
0.0851 |
| Weighted residual factors for all reflections included in the refinement |
0.0897 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224438.html