Information card for entry 2224447
| Chemical name |
3-Allyl-1,5-dibenzyl-1,5-benzodiazepine-2,4-dione |
| Formula |
C26 H24 N2 O2 |
| Calculated formula |
C26 H24 N2 O2 |
| SMILES |
O=C1N(c2c(N(C(=O)C1CC=C)Cc1ccccc1)cccc2)Cc1ccccc1 |
| Title of publication |
3-Allyl-1,5-dibenzyl-1,5-benzodiazepine-2,4-dione |
| Authors of publication |
Jabli, Hind; Kandri Rodi, Y.; Saffon, Natalie; Essassi, El Mokhtar; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
12 |
| Pages of publication |
o3150 |
| a |
9.2603 ± 0.0004 Å |
| b |
14.0037 ± 0.0006 Å |
| c |
16.2249 ± 0.0007 Å |
| α |
90° |
| β |
91.996 ± 0.001° |
| γ |
90° |
| Cell volume |
2102.74 ± 0.16 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0898 |
| Residual factor for significantly intense reflections |
0.0425 |
| Weighted residual factors for significantly intense reflections |
0.0943 |
| Weighted residual factors for all reflections included in the refinement |
0.1168 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.997 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2224447.html