Information card for entry 2225712
| Chemical name |
Dibromoido(4'-phenyl-2,2':6',2''-terpyridyl)copper(II) monohydrate |
| Formula |
C21 H16 Br2 Cu N3 O0.5 |
| Calculated formula |
C21 H16 Br2 Cu N3 O0.5 |
| SMILES |
[Cu]12(Br)(Br)[n]3ccccc3c3[n]1c(cc(c3)c1ccccc1)c1[n]2cccc1.O |
| Title of publication |
Dibromido(4'-phenyl-2,2':6',2''-terpyridyl)copper(II) hemihydrate |
| Authors of publication |
Ma, Zhen; Bi, Chunyan; Ran, Guangyou; Wu, Zhang; Liu, Baoqing; Hu, Miao; Xing, Yanpeng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
m465 |
| a |
10.1369 ± 0.0016 Å |
| b |
10.8131 ± 0.0017 Å |
| c |
18.688 ± 0.003 Å |
| α |
73.629 ± 0.003° |
| β |
77.088 ± 0.004° |
| γ |
87.567 ± 0.005° |
| Cell volume |
1915.2 ± 0.5 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0408 |
| Residual factor for significantly intense reflections |
0.0323 |
| Weighted residual factors for significantly intense reflections |
0.0745 |
| Weighted residual factors for all reflections included in the refinement |
0.0792 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.015 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225712.html