Information card for entry 2225751
| Chemical name |
2,2'-[(3a<i>RS</i>,7a<i>RS</i>)-Perhydrobenzimidazole- 1,3-diyl)bis(methylene)]diphenol |
| Formula |
C21 H26 N2 O2 |
| Calculated formula |
C21 H26 N2 O2 |
| SMILES |
Oc1c(CN2CN([C@@H]3[C@@H]2CCCC3)Cc2c(O)cccc2)cccc1.Oc1c(CN2CN([C@H]3[C@H]2CCCC3)Cc2c(O)cccc2)cccc1 |
| Title of publication |
2,2'-[(3a<i>RS</i>,7a<i>RS</i>)-Perhydrobenzimidazole-1,3-diyl)bis(methylene)]diphenol |
| Authors of publication |
Rivera, Augusto; Quiroga, Diego; Ríos-Motta, Jaime; Dušek, Michal; Fejfarová, Karla |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
4 |
| Pages of publication |
o931 |
| a |
5.5177 ± 0.0001 Å |
| b |
12.0432 ± 0.0004 Å |
| c |
14.3752 ± 0.0004 Å |
| α |
69.705 ± 0.003° |
| β |
89.341 ± 0.002° |
| γ |
81.751 ± 0.002° |
| Cell volume |
885.92 ± 0.05 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0419 |
| Residual factor for significantly intense reflections |
0.0376 |
| Weighted residual factors for significantly intense reflections |
0.1162 |
| Weighted residual factors for all reflections included in the refinement |
0.1182 |
| Goodness-of-fit parameter for all reflections included in the refinement |
2.41 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225751.html