Information card for entry 2225770
| Chemical name |
5,10,15,20-Tetra-2-furylporphyrin |
| Formula |
C36 H22 N4 O4 |
| Calculated formula |
C36 H22 N4 O4 |
| SMILES |
c12nc(=C(c3[nH]c(cc3)C(=c3ccc(n3)C(=c3[nH]c(=C2c2ccco2)cc3)c2occc2)c2ccco2)c2occc2)cc1 |
| Title of publication |
5,10,15,20-Tetra-2-furylporphyrin |
| Authors of publication |
Ghosh, Avijit; Butcher, Ray J.; Mobin, Shaikh M.; Ravikanth, M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
5 |
| Pages of publication |
o1160 - o1161 |
| a |
9.6068 ± 0.0004 Å |
| b |
7.3956 ± 0.0003 Å |
| c |
18.177 ± 0.0007 Å |
| α |
90° |
| β |
97.419 ± 0.004° |
| γ |
90° |
| Cell volume |
1280.63 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1098 |
| Residual factor for significantly intense reflections |
0.0566 |
| Weighted residual factors for significantly intense reflections |
0.1257 |
| Weighted residual factors for all reflections included in the refinement |
0.1399 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.941 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2225770.html