Information card for entry 2226192
| Chemical name |
2-[(2,4-Dihydroxybenzylidene)amino]-3',6'-bis(ethylamino)spiro[isoindoline- 1,9'-xanthen]-3-one |
| Formula |
C35 H36 N4 O4 |
| Calculated formula |
C35 H36 N4 O4 |
| SMILES |
CCN(CC)c1ccc2c(c1)Oc1cc(ccc1C12c2ccccc2C(=O)N1/N=C/c1ccc(cc1O)O)N(CC)CC |
| Title of publication |
2-[(2,4-Dihydroxybenzylidene)amino]-3',6'-bis(ethylamino)spiro[isoindoline-1,9'-xanthen]-3-one |
| Authors of publication |
Xu, Zhi-Hong; Zhang, Yan-Ling; Zhao, Yan-Ru; Yang, Feng-Ling |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
6 |
| Pages of publication |
o1504 |
| a |
9.4461 ± 0.0004 Å |
| b |
26.6905 ± 0.0012 Å |
| c |
12.2453 ± 0.0005 Å |
| α |
90° |
| β |
104.423 ± 0.002° |
| γ |
90° |
| Cell volume |
2990 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1863 |
| Residual factor for significantly intense reflections |
0.0704 |
| Weighted residual factors for significantly intense reflections |
0.1589 |
| Weighted residual factors for all reflections included in the refinement |
0.2152 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226192.html