Information card for entry 2226427
| Chemical name |
1,1'-(Ethane-1,2-diyl)bis(indoline-2,3-dione) |
| Formula |
C18 H12 N2 O4 |
| Calculated formula |
C18 H12 N2 O4 |
| SMILES |
O=C1C(=O)c2c(N1CCN1c3ccccc3C(=O)C1=O)cccc2 |
| Title of publication |
1,1'-(Ethane-1,2-diyl)bis(indoline-2,3-dione) |
| Authors of publication |
Wang, Yao; Cao, Sheng-Li; Wan, Chong-Qing; Yuan, Jing-Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
o1569 - o1570 |
| a |
12.2572 ± 0.0003 Å |
| b |
5.2314 ± 0.0001 Å |
| c |
12.5122 ± 0.0003 Å |
| α |
90° |
| β |
115.747 ± 0.001° |
| γ |
90° |
| Cell volume |
722.66 ± 0.03 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0466 |
| Residual factor for significantly intense reflections |
0.0402 |
| Weighted residual factors for significantly intense reflections |
0.0978 |
| Weighted residual factors for all reflections included in the refinement |
0.1017 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226427.html