Information card for entry 2226739
| Chemical name |
Bis(2,9-dimethyl-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(nitrato- κ^2^<i>O</i>,<i>O</i>')lead(II) |
| Formula |
C28 H24 N6 O6 Pb |
| Calculated formula |
C28 H24 N6 O6 Pb |
| SMILES |
[Pb]1234(ON(=[O]1)=O)(ON(=O)=O2)([n]1c2c5[n]3c(ccc5ccc2ccc1C)C)[n]1c2c3[n]4c(ccc3ccc2ccc1C)C |
| Title of publication |
Bis(2,9-dimethyl-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(nitrato-κ^2^<i>O</i>,<i>O</i>')lead(II) |
| Authors of publication |
Shen, Fwu Ming; Lush, Shie Fu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
7 |
| Pages of publication |
m805 - m806 |
| a |
19.9164 ± 0.0004 Å |
| b |
8.0173 ± 0.0001 Å |
| c |
16.3575 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2611.9 ± 0.08 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.03 |
| Residual factor for significantly intense reflections |
0.0207 |
| Weighted residual factors for significantly intense reflections |
0.039 |
| Weighted residual factors for all reflections included in the refinement |
0.0399 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.908 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226739.html