Information card for entry 2226919
| Chemical name |
1-(2,4-Dinitrophenyl)-2-(1,2,3,4-tetrahydronaphthalen-1-ylidene)hydrazine |
| Formula |
C16 H14 N4 O4 |
| Calculated formula |
C16 H14 N4 O4 |
| SMILES |
O=N(=O)c1c(N/N=C\2c3ccccc3CCC2)ccc(N(=O)=O)c1 |
| Title of publication |
1-(2,4-Dinitrophenyl)-2-(1,2,3,4-tetrahydronaphthalen-1-ylidene)hydrazine |
| Authors of publication |
Danish, M.; Hamid, Masood; Tahir, M. Nawaz; Ahmad, Nazir; Ghafoor, Sabiha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
8 |
| Pages of publication |
o2100 |
| a |
14.8627 ± 0.0008 Å |
| b |
13.8704 ± 0.0007 Å |
| c |
7.3493 ± 0.0004 Å |
| α |
90° |
| β |
99.211 ± 0.003° |
| γ |
90° |
| Cell volume |
1495.53 ± 0.14 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0907 |
| Residual factor for significantly intense reflections |
0.0521 |
| Weighted residual factors for significantly intense reflections |
0.124 |
| Weighted residual factors for all reflections included in the refinement |
0.1433 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226919.html