Information card for entry 2227290
| Chemical name |
2-(1,2,3,4-Tetrahydro-1-naphthyl)imidazolium chloride monohydrate |
| Formula |
C13 H17 Cl N2 O |
| Calculated formula |
C13 H17 Cl N2 O |
| SMILES |
[Cl-].[nH]1cc[nH+]c1C1CCCc2c1cccc2.O |
| Title of publication |
2-(1,2,3,4-Tetrahydro-1-naphthyl)imidazolium chloride monohydrate |
| Authors of publication |
Bruni, Bruno; Bartolucci, Gianluca; Ciattini, Samuele; Coran, Silvia |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
9 |
| Pages of publication |
o2321 |
| a |
9.8299 ± 0.0001 Å |
| b |
12.6671 ± 0.0002 Å |
| c |
10.5375 ± 0.0002 Å |
| α |
90° |
| β |
92.666 ± 0.001° |
| γ |
90° |
| Cell volume |
1310.67 ± 0.04 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0345 |
| Residual factor for significantly intense reflections |
0.033 |
| Weighted residual factors for significantly intense reflections |
0.0898 |
| Weighted residual factors for all reflections included in the refinement |
0.0907 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.089 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227290.html