Information card for entry 2227344
| Chemical name |
Tetramethyl 1,1,2-triphenyl-2<i>H</i>-1λ^5^-phosphole-2,3,4,5-tetracarboxylate |
| Formula |
C30 H27 O8 P |
| Calculated formula |
C30 H27 O8 P |
| SMILES |
P1(C(C(=C(C=1C(=O)OC)C(=O)OC)C(=O)OC)(C(=O)OC)c1ccccc1)(c1ccccc1)c1ccccc1 |
| Title of publication |
Tetramethyl 1,1,2-triphenyl-2<i>H</i>-1λ^5^-phosphole-2,3,4,5-tetracarboxylate |
| Authors of publication |
Krawczyk, Krzysztof K.; Wojtasiewicz, Krystyna; Maurin, Jan K.; Gronowska, Ewa; Czarnocki, Zbigniew |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2791 |
| a |
10.445 ± 0.006 Å |
| b |
10.897 ± 0.004 Å |
| c |
13.778 ± 0.004 Å |
| α |
73.93 ± 0.03° |
| β |
72.54 ± 0.04° |
| γ |
69.24 ± 0.04° |
| Cell volume |
1373 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0455 |
| Residual factor for significantly intense reflections |
0.0412 |
| Weighted residual factors for significantly intense reflections |
0.1239 |
| Weighted residual factors for all reflections included in the refinement |
0.1277 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.095 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227344.html