Information card for entry 2227863
| Chemical name |
4'-Chlorobiphenyl-3-yl 2,2,2-trichloroethyl sulfate |
| Formula |
C14 H10 Cl4 O4 S |
| Calculated formula |
C14 H10 Cl4 O4 S |
| SMILES |
S(=O)(=O)(Oc1cc(c2ccc(Cl)cc2)ccc1)OCC(Cl)(Cl)Cl |
| Title of publication |
4'-Chlorobiphenyl-3-yl 2,2,2-trichloroethyl sulfate |
| Authors of publication |
Li, Xueshu; Parkin, Sean; Duffel, Michael W.; Robertson, Larry W.; Lehmler, Hans-Joachim |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
9 |
| Pages of publication |
o2306 |
| a |
21.19 ± 0.0003 Å |
| b |
5.8543 ± 0.0001 Å |
| c |
26.6803 ± 0.0005 Å |
| α |
90° |
| β |
98.304 ± 0.001° |
| γ |
90° |
| Cell volume |
3275.06 ± 0.1 Å3 |
| Cell temperature |
90 ± 0.2 K |
| Ambient diffraction temperature |
90 ± 0.2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
I 1 2/a 1 |
| Hall space group symbol |
-I 2ya |
| Residual factor for all reflections |
0.033 |
| Residual factor for significantly intense reflections |
0.0257 |
| Weighted residual factors for significantly intense reflections |
0.0641 |
| Weighted residual factors for all reflections included in the refinement |
0.0672 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227863.html