Information card for entry 2227865
| Common name |
17-Acetoxymulinic acid |
| Chemical name |
5a-acetoxymethyl-3-isopropyl-8-methyl-1,2,3,3a,4,5,5a,6,7,10,10a,10b- dodecahydro-7,10-<i>endo</i>-epidioxycyclohepta[<i>e</i>]indene- 3a-carboxylic acid |
| Formula |
C22 H32 O6 |
| Calculated formula |
C22 H32 O6 |
| SMILES |
CC(=O)OC[C@]12CC[C@]3([C@H]([C@@H]2[C@@H]2OO[C@H](C1)C(=C2)C)CC[C@@H]3C(C)C)C(=O)O |
| Title of publication |
17-Acetoxymulinic acid |
| Authors of publication |
Brito, Iván; Bórquez, Jorge; Albanez, Joselyn; Bolte, Michael; Peña-Rodríguez, Luis Manuel |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
9 |
| Pages of publication |
o2452 - o2453 |
| a |
11.9171 ± 0.0012 Å |
| b |
7.3523 ± 0.0004 Å |
| c |
23.679 ± 0.002 Å |
| α |
90° |
| β |
92.775 ± 0.008° |
| γ |
90° |
| Cell volume |
2072.3 ± 0.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0867 |
| Residual factor for significantly intense reflections |
0.0551 |
| Weighted residual factors for significantly intense reflections |
0.1267 |
| Weighted residual factors for all reflections included in the refinement |
0.137 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.903 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227865.html