Information card for entry 2228171
| Common name |
3,4-diclorocamphorquinoxaline |
| Chemical name |
(1<i>R</i>,4<i>S</i>)-7,8-Dichloro-1,2,3,4-tetrahydro-1,11,11-trimethyl- 1,4-methanophenazine |
| Formula |
C16 H16 Cl2 N2 |
| Calculated formula |
C16 H16 Cl2 N2 |
| SMILES |
Clc1cc2nc3c(nc2cc1Cl)[C@@H]1C([C@@]3(C)CC1)(C)C |
| Title of publication |
(1<i>R</i>,4<i>S</i>)-7,8-Dichloro-1,2,3,4-tetrahydro-1,11,11-trimethyl-1,4-methanophenazine |
| Authors of publication |
Crundwell, Guy; Glagovich, Neil |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o3042 |
| a |
6.9741 ± 0.0003 Å |
| b |
13.0892 ± 0.0005 Å |
| c |
16.9594 ± 0.0005 Å |
| α |
90° |
| β |
101.701 ± 0.003° |
| γ |
90° |
| Cell volume |
1515.97 ± 0.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1045 |
| Residual factor for significantly intense reflections |
0.0584 |
| Weighted residual factors for significantly intense reflections |
0.1417 |
| Weighted residual factors for all reflections included in the refinement |
0.1628 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.927 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228171.html